About (6S)-1,5-diazabicyclo[4.3.1]decane
(6S)-1,5-diazabicyclo[4.3.1]decane (PubChem CID 118586261) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (6S)-1,5-diazabicyclo[4.3.1]decane.
Molecular Properties
| Compound Name | (6S)-1,5-diazabicyclo[4.3.1]decane |
| PubChem CID | 118586261 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (6S)-1,5-diazabicyclo[4.3.1]decane |
| SMILES | C1CN[C@H]2CCCN(C1)C2 |
| InChI | InChI=1S/C8H16N2/c1-3-8-7-10(5-1)6-2-4-9-8/h8-9H,1-7H2/t8-/m0/s1 |
| InChIKey | YHMNABUJNWTKBZ-QMMMGPOBSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6S)-1,5-diazabicyclo[4.3.1]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1,5-diazabicyclo[4.3.1]decane?
The IUPAC name of (6S)-1,5-diazabicyclo[4.3.1]decane (CID 118586261) is (6S)-1,5-diazabicyclo[4.3.1]decane.
What is the SMILES notation for (6S)-1,5-diazabicyclo[4.3.1]decane?
The canonical SMILES for (6S)-1,5-diazabicyclo[4.3.1]decane is C1CN[C@H]2CCCN(C1)C2.
What is the InChIKey of (6S)-1,5-diazabicyclo[4.3.1]decane?
The InChIKey is YHMNABUJNWTKBZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H16N2/c1-3-8-7-10(5-1)6-2-4-9-8/h8-9H,1-7H2/t8-/m0/s1.
What are the key properties of (6S)-1,5-diazabicyclo[4.3.1]decane?
(6S)-1,5-diazabicyclo[4.3.1]decane has a molecular weight of 140.23 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1,5-diazabicyclo[4.3.1]decane is sourced from PubChem (CID 118586261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).