C15H20N4O2 — CID 118586321
6-amino-3-(4-ethylcyclohexyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 118586321) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-amino-3-(4-ethylcyclohexyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-amino-3-(4-ethylcyclohexyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118586321 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-amino-3-(4-ethylcyclohexyl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CCC1CCC(n2c(=O)[nH]c3ncc(N)cc3c2=O)CC1 |
| InChI | InChI=1S/C15H20N4O2/c1-2-9-3-5-11(6-4-9)19-14(20)12-7-10(16)8-17-13(12)18-15(19)21/h7-9,11H,2-6,16H2,1H3,(H,17,18,21) |
| InChIKey | RUIBOTJWFKGLEJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |