About 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole
2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 11858639) has the molecular formula C9H8FNO
and a molecular weight of 165.17 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole |
| PubChem CID | 11858639 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1ccc(C2=NCCO2)cc1 |
| InChI | InChI=1S/C9H8FNO/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4H,5-6H2 |
| InChIKey | YSYWCNBSAQZIRO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole (CID 11858639) is 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole is Fc1ccc(C2=NCCO2)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
The InChIKey is YSYWCNBSAQZIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4H,5-6H2.
What are the key properties of 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole?
2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole has a molecular weight of 165.17 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 11858639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).