C36H54O8 — CID 118586527
4-[4-(4-hydroxyhexyl)-6-[4-hydroxy-5-[2-(4-hydroxyphenyl)-6-pentyl-1,3-dioxan-4-yl]pentyl]-1,3-dioxan-2-yl]phenol (PubChem CID 118586527) has the molecular formula C36H54O8 and a molecular weight of 614.82 g/mol. Its IUPAC name is 4-[4-(4-hydroxyhexyl)-6-[4-hydroxy-5-[2-(4-hydroxyphenyl)-6-pentyl-1,3-dioxan-4-yl]pentyl]-1,3-dioxan-2-yl]phenol.
| Compound Name | 4-[4-(4-hydroxyhexyl)-6-[4-hydroxy-5-[2-(4-hydroxyphenyl)-6-pentyl-1,3-dioxan-4-yl]pentyl]-1,3-dioxan-2-yl]phenol |
|---|---|
| PubChem CID | 118586527 |
| Molecular Formula | C36H54O8 |
| Molecular Weight | 614.82 g/mol |
| Exact Mass | 614.38 |
| IUPAC Name | 4-[4-(4-hydroxyhexyl)-6-[4-hydroxy-5-[2-(4-hydroxyphenyl)-6-pentyl-1,3-dioxan-4-yl]pentyl]-1,3-dioxan-2-yl]phenol |
| SMILES | CCCCCC1CC(CC(O)CCCC2CC(CCCC(O)CC)OC(c3ccc(O)cc3)O2)OC(c2ccc(O)cc2)O1 |
| InChI | InChI=1S/C36H54O8/c1-3-5-6-11-31-24-34(44-36(41-31)26-16-20-29(39)21-17-26)22-30(40)10-8-13-33-23-32(12-7-9-27(37)4-2)42-35(43-33)25-14-18-28(38)19-15-25/h14-21,27,30-40H,3-13,22-24H2,1-2H3 |
| InChIKey | ZJIAIUGJHKFMQY-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.82 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|