C27H30O6 — CID 118586558
2,12-dimethyl-6-[(2-methylpropan-2-yl)oxy]-16-propan-2-yloxy-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaene-10,20-dione (PubChem CID 118586558) has the molecular formula C27H30O6 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2,12-dimethyl-6-[(2-methylpropan-2-yl)oxy]-16-propan-2-yloxy-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaene-10,20-dione.
| Compound Name | 2,12-dimethyl-6-[(2-methylpropan-2-yl)oxy]-16-propan-2-yloxy-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaene-10,20-dione |
|---|---|
| PubChem CID | 118586558 |
| Molecular Formula | C27H30O6 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2,12-dimethyl-6-[(2-methylpropan-2-yl)oxy]-16-propan-2-yloxy-9,19-dioxapentacyclo[10.8.0.02,11.03,8.013,18]icosa-3(8),4,6,13(18),14,16-hexaene-10,20-dione |
| SMILES | CC(C)Oc1ccc2c(c1)OC(=O)C1C2(C)C2C(=O)Oc3cc(OC(C)(C)C)ccc3C12C |
| InChI | InChI=1S/C27H30O6/c1-14(2)30-15-8-10-17-19(12-15)31-23(28)21-26(17,6)22-24(29)32-20-13-16(33-25(3,4)5)9-11-18(20)27(21,22)7/h8-14,21-22H,1-7H3 |
| InChIKey | SDSMYHHMVXRTIA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|