C13H17N — CID 118586766
(1Z)-1,2-dimethyl-3,4,5,6-tetrahydro-3-benzazocine (PubChem CID 118586766) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (1Z)-1,2-dimethyl-3,4,5,6-tetrahydro-3-benzazocine.
| Compound Name | (1Z)-1,2-dimethyl-3,4,5,6-tetrahydro-3-benzazocine |
|---|---|
| PubChem CID | 118586766 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (1Z)-1,2-dimethyl-3,4,5,6-tetrahydro-3-benzazocine |
| SMILES | C/C1=C(\C)c2ccccc2CCCN1 |
| InChI | InChI=1S/C13H17N/c1-10-11(2)14-9-5-7-12-6-3-4-8-13(10)12/h3-4,6,8,14H,5,7,9H2,1-2H3/b11-10- |
| InChIKey | DSOFJLSXJZCNLW-KHPPLWFESA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |