C32H20BrN5 — CID 118586796
8-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]pyrido[3,2-b]indole (PubChem CID 118586796) has the molecular formula C32H20BrN5 and a molecular weight of 554.45 g/mol. Its IUPAC name is 8-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]pyrido[3,2-b]indole.
| Compound Name | 8-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 118586796 |
| Molecular Formula | C32H20BrN5 |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | 8-bromo-5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]pyrido[3,2-b]indole |
| SMILES | Brc1ccc2c(c1)c1ncccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C32H20BrN5/c33-24-15-18-27-26(20-24)29-28(12-7-19-34-29)38(27)25-16-13-23(14-17-25)32-36-30(21-8-3-1-4-9-21)35-31(37-32)22-10-5-2-6-11-22/h1-20H |
| InChIKey | RJTZQAPIRVWVRB-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |