About (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine
(2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine (PubChem CID 118586817) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine.
Analyze (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine?
The IUPAC name of (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine (CID 118586817) is (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine.
What is the SMILES notation for (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine?
The canonical SMILES for (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine is C/C1=C(\C)OCCCCN1.
What is the InChIKey of (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine?
The InChIKey is HJFZYQDIPLSCIH-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H15NO/c1-7-8(2)10-6-4-3-5-9-7/h9H,3-6H2,1-2H3/b8-7-.
What are the key properties of (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine?
(2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine has a molecular weight of 141.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2,3-dimethyl-5,6,7,8-tetrahydro-4H-1,4-oxazocine is sourced from PubChem (CID 118586817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).