C9H17NO2 — CID 118586820
(4Z)-4,5-dimethyl-2,3,7,8,9,10-hexahydro-1,6,3-dioxazecine (PubChem CID 118586820) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (4Z)-4,5-dimethyl-2,3,7,8,9,10-hexahydro-1,6,3-dioxazecine.
| Compound Name | (4Z)-4,5-dimethyl-2,3,7,8,9,10-hexahydro-1,6,3-dioxazecine |
|---|---|
| PubChem CID | 118586820 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (4Z)-4,5-dimethyl-2,3,7,8,9,10-hexahydro-1,6,3-dioxazecine |
| SMILES | C/C1=C(\C)OCCCCOCN1 |
| InChI | InChI=1S/C9H17NO2/c1-8-9(2)12-6-4-3-5-11-7-10-8/h10H,3-7H2,1-2H3/b9-8- |
| InChIKey | HGKGFVNZIKLPKS-HJWRWDBZSA-N |
| XLogP | 1.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |