C8H13NO — CID 118586826
(2Z,6Z)-2,3-dimethyl-5,8-dihydro-4H-1,4-oxazocine (PubChem CID 118586826) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (2Z,6Z)-2,3-dimethyl-5,8-dihydro-4H-1,4-oxazocine.
| Compound Name | (2Z,6Z)-2,3-dimethyl-5,8-dihydro-4H-1,4-oxazocine |
|---|---|
| PubChem CID | 118586826 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2Z,6Z)-2,3-dimethyl-5,8-dihydro-4H-1,4-oxazocine |
| SMILES | C/C1=C(\C)OC/C=C\CN1 |
| InChI | InChI=1S/C8H13NO/c1-7-8(2)10-6-4-3-5-9-7/h3-4,9H,5-6H2,1-2H3/b4-3-,8-7- |
| InChIKey | TUXKNUHPSAHDFN-KPDBFRNYSA-N |
| XLogP | 1.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|