About 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine
4,5-dimethyl-2,3-dihydro-1H-3-benzazepine (PubChem CID 118587446) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine.
Molecular Properties
| Compound Name | 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine |
| PubChem CID | 118587446 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine |
| SMILES | CC1=C(C)c2ccccc2CCN1 |
| InChI | InChI=1S/C12H15N/c1-9-10(2)13-8-7-11-5-3-4-6-12(9)11/h3-6,13H,7-8H2,1-2H3 |
| InChIKey | XJUWVSRGSGSJEL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine?
The IUPAC name of 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine (CID 118587446) is 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine.
What is the SMILES notation for 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine?
The canonical SMILES for 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine is CC1=C(C)c2ccccc2CCN1.
What is the InChIKey of 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine?
The InChIKey is XJUWVSRGSGSJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-9-10(2)13-8-7-11-5-3-4-6-12(9)11/h3-6,13H,7-8H2,1-2H3.
What are the key properties of 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine?
4,5-dimethyl-2,3-dihydro-1H-3-benzazepine has a molecular weight of 173.26 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2,3-dihydro-1H-3-benzazepine is sourced from PubChem (CID 118587446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).