C11H19BrN2 — CID 118587589
2-bromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[2,3-b]indole (PubChem CID 118587589) has the molecular formula C11H19BrN2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 2-bromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[2,3-b]indole.
| Compound Name | 2-bromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 118587589 |
| Molecular Formula | C11H19BrN2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-bromo-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[2,3-b]indole |
| SMILES | BrC1CCC2C(N1)NC1CCCCC12 |
| InChI | InChI=1S/C11H19BrN2/c12-10-6-5-8-7-3-1-2-4-9(7)13-11(8)14-10/h7-11,13-14H,1-6H2 |
| InChIKey | IFQBDFVLWFHLIW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|