C17H11Cl2F3N4O2S — CID 118587700
2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 118587700) has the molecular formula C17H11Cl2F3N4O2S and a molecular weight of 463.27 g/mol. Its IUPAC name is 2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 118587700 |
| Molecular Formula | C17H11Cl2F3N4O2S |
| Molecular Weight | 463.27 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 2-amino-4-(5,7-dichloro-2,3-dihydro-1-benzofuran-4-yl)-N-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Nc1nc(-c2c(Cl)cc(Cl)c3c2CCO3)c2cc(C(=O)NCC(F)(F)F)sc2n1 |
| InChI | InChI=1S/C17H11Cl2F3N4O2S/c18-8-4-9(19)13-6(1-2-28-13)11(8)12-7-3-10(14(27)24-5-17(20,21)22)29-15(7)26-16(23)25-12/h3-4H,1-2,5H2,(H,24,27)(H2,23,25,26) |
| InChIKey | OBSHGRYPULHYSW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |