C23H24ClN3O7S — CID 118588004
(3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 118588004) has the molecular formula C23H24ClN3O7S and a molecular weight of 521.98 g/mol. Its IUPAC name is (3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 118588004 |
| Molecular Formula | C23H24ClN3O7S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | (3R,4R)-3-(4-chlorophenyl)-2-[(1S,2S)-2-(methanesulfonamido)cyclohexyl]-6-nitro-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | CS(=O)(=O)N[C@H]1CCCC[C@@H]1N1C(=O)c2ccc([N+](=O)[O-])cc2[C@@H](C(=O)O)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O7S/c1-35(33,34)25-18-4-2-3-5-19(18)26-21(13-6-8-14(24)9-7-13)20(23(29)30)17-12-15(27(31)32)10-11-16(17)22(26)28/h6-12,18-21,25H,2-5H2,1H3,(H,29,30)/t18-,19-,20+,21-/m0/s1 |
| InChIKey | LQTVTXARYMOWBS-BURNTYAHSA-N |
| XLogP | 3.47 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|