C6H12O4 — CID 11858804
(3S,4R)-1,3,4-trihydroxyhexan-2-one (PubChem CID 11858804) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is (3S,4R)-1,3,4-trihydroxyhexan-2-one.
| Compound Name | (3S,4R)-1,3,4-trihydroxyhexan-2-one |
|---|---|
| PubChem CID | 11858804 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | (3S,4R)-1,3,4-trihydroxyhexan-2-one |
| SMILES | CC[C@@H](O)[C@H](O)C(=O)CO |
| InChI | InChI=1S/C6H12O4/c1-2-4(8)6(10)5(9)3-7/h4,6-8,10H,2-3H2,1H3/t4-,6+/m1/s1 |
| InChIKey | VLNMULGCQJQMTL-XINAWCOVSA-N |
| XLogP | -1.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |