About [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane
[(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane (PubChem CID 11858809) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane.
Molecular Properties
| Compound Name | [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane |
| PubChem CID | 11858809 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane |
| SMILES | C=C(C)CO[C@H](/C=C\C)C1CCCCC1 |
| InChI | InChI=1S/C14H24O/c1-4-8-14(15-11-12(2)3)13-9-6-5-7-10-13/h4,8,13-14H,2,5-7,9-11H2,1,3H3/b8-4-/t14-/m1/s1 |
| InChIKey | COSVEDVNMCVVCA-SMGNDMQFSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane?
The IUPAC name of [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane (CID 11858809) is [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane.
What is the SMILES notation for [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane?
The canonical SMILES for [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane is C=C(C)CO[C@H](/C=C\C)C1CCCCC1.
What is the InChIKey of [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane?
The InChIKey is COSVEDVNMCVVCA-SMGNDMQFSA-N. The full InChI is InChI=1S/C14H24O/c1-4-8-14(15-11-12(2)3)13-9-6-5-7-10-13/h4,8,13-14H,2,5-7,9-11H2,1,3H3/b8-4-/t14-/m1/s1.
What are the key properties of [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane?
[(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane has a molecular weight of 208.34 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,1S)-1-(2-methylprop-2-enoxy)but-2-enyl]cyclohexane is sourced from PubChem (CID 11858809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).