C20H40O2Si — CID 11858811
(E,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2,4-dimethylhex-5-en-1-ol (PubChem CID 11858811) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (E,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2,4-dimethylhex-5-en-1-ol.
| Compound Name | (E,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2,4-dimethylhex-5-en-1-ol |
|---|---|
| PubChem CID | 11858811 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (E,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2,4-dimethylhex-5-en-1-ol |
| SMILES | C[C@@H](/C=C/C1CCCCC1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C20H40O2Si/c1-16(13-14-18-11-9-8-10-12-18)19(17(2)15-21)22-23(6,7)20(3,4)5/h13-14,16-19,21H,8-12,15H2,1-7H3/b14-13+/t16-,17-,19+/m0/s1 |
| InChIKey | AFWZMJCUHOAPML-MWERVGROSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|