About 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one
5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one (PubChem CID 118588309) has the molecular formula C4H4FNO4S
and a molecular weight of 181.14 g/mol. Its IUPAC name is 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one.
Molecular Properties
| Compound Name | 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one |
| PubChem CID | 118588309 |
| Molecular Formula | C4H4FNO4S |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 180.98 |
| IUPAC Name | 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one |
| SMILES | CC1=C(F)C(=O)NS(=O)(=O)O1 |
| InChI | InChI=1S/C4H4FNO4S/c1-2-3(5)4(7)6-11(8,9)10-2/h1H3,(H,6,7) |
| InChIKey | NBVJRCVVCDLCDW-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one?
The IUPAC name of 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one (CID 118588309) is 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one.
What is the SMILES notation for 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one?
The canonical SMILES for 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one is CC1=C(F)C(=O)NS(=O)(=O)O1.
What is the InChIKey of 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one?
The InChIKey is NBVJRCVVCDLCDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4FNO4S/c1-2-3(5)4(7)6-11(8,9)10-2/h1H3,(H,6,7).
What are the key properties of 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one?
5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one has a molecular weight of 181.14 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyl-2,2-dioxooxathiazin-4-one is sourced from PubChem (CID 118588309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).