C16H15ClF8N4O4S — CID 118588628
4-(2-chloro-2,2-difluoroethyl)-1-[[2-(methoxymethyl)-6-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 118588628) has the molecular formula C16H15ClF8N4O4S and a molecular weight of 546.82 g/mol. Its IUPAC name is 4-(2-chloro-2,2-difluoroethyl)-1-[[2-(methoxymethyl)-6-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(2-chloro-2,2-difluoroethyl)-1-[[2-(methoxymethyl)-6-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118588628 |
| Molecular Formula | C16H15ClF8N4O4S |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | 4-(2-chloro-2,2-difluoroethyl)-1-[[2-(methoxymethyl)-6-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | COCc1nn2c(CN3CC(=O)C(CC(F)(F)Cl)C3)c(C(F)(F)F)nc2s1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H14ClF5N4O2S.C2HF3O2/c1-26-6-10-22-24-8(11(14(18,19)20)21-12(24)27-10)4-23-3-7(9(25)5-23)2-13(15,16)17;3-2(4,5)1(6)7/h7H,2-6H2,1H3;(H,6,7) |
| InChIKey | NFPUUIMOCZRCEW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|