C16H13N5 — CID 118588652
6-(9H-fluoren-1-yl)-1,2,4-triazine-3,5-diamine (PubChem CID 118588652) has the molecular formula C16H13N5 and a molecular weight of 275.32 g/mol. Its IUPAC name is 6-(9H-fluoren-1-yl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(9H-fluoren-1-yl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 118588652 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-(9H-fluoren-1-yl)-1,2,4-triazine-3,5-diamine |
| SMILES | Nc1nnc(-c2cccc3c2Cc2ccccc2-3)c(N)n1 |
| InChI | InChI=1S/C16H13N5/c17-15-14(20-21-16(18)19-15)12-7-3-6-11-10-5-2-1-4-9(10)8-13(11)12/h1-7H,8H2,(H4,17,18,19,21) |
| InChIKey | PLBGQDJTZSEIIK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |