About 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine
4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine (PubChem CID 118588757) has the molecular formula C13H21F2N
and a molecular weight of 229.31 g/mol. Its IUPAC name is 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 118588757 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CCCCCCC1C(N)=CC=C(F)C1(C)F |
| InChI | InChI=1S/C13H21F2N/c1-3-4-5-6-7-10-11(16)8-9-12(14)13(10,2)15/h8-10H,3-7,16H2,1-2H3 |
| InChIKey | PLPJJPFKFNXDIV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine (CID 118588757) is 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine is CCCCCCC1C(N)=CC=C(F)C1(C)F.
What is the InChIKey of 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is PLPJJPFKFNXDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F2N/c1-3-4-5-6-7-10-11(16)8-9-12(14)13(10,2)15/h8-10H,3-7,16H2,1-2H3.
What are the key properties of 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine?
4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 229.31 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-6-hexyl-5-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 118588757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).