About 1-amino-2-hexyl-1,3-dihydroinden-2-ol
1-amino-2-hexyl-1,3-dihydroinden-2-ol (PubChem CID 118588844) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-amino-2-hexyl-1,3-dihydroinden-2-ol.
Molecular Properties
| Compound Name | 1-amino-2-hexyl-1,3-dihydroinden-2-ol |
| PubChem CID | 118588844 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 1-amino-2-hexyl-1,3-dihydroinden-2-ol |
| SMILES | CCCCCCC1(O)Cc2ccccc2C1N |
| InChI | InChI=1S/C15H23NO/c1-2-3-4-7-10-15(17)11-12-8-5-6-9-13(12)14(15)16/h5-6,8-9,14,17H,2-4,7,10-11,16H2,1H3 |
| InChIKey | UYISESYXXRHTSJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2-hexyl-1,3-dihydroinden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-hexyl-1,3-dihydroinden-2-ol?
The IUPAC name of 1-amino-2-hexyl-1,3-dihydroinden-2-ol (CID 118588844) is 1-amino-2-hexyl-1,3-dihydroinden-2-ol.
What is the SMILES notation for 1-amino-2-hexyl-1,3-dihydroinden-2-ol?
The canonical SMILES for 1-amino-2-hexyl-1,3-dihydroinden-2-ol is CCCCCCC1(O)Cc2ccccc2C1N.
What is the InChIKey of 1-amino-2-hexyl-1,3-dihydroinden-2-ol?
The InChIKey is UYISESYXXRHTSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-2-3-4-7-10-15(17)11-12-8-5-6-9-13(12)14(15)16/h5-6,8-9,14,17H,2-4,7,10-11,16H2,1H3.
What are the key properties of 1-amino-2-hexyl-1,3-dihydroinden-2-ol?
1-amino-2-hexyl-1,3-dihydroinden-2-ol has a molecular weight of 233.35 g/mol, XLogP of 2.94, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-hexyl-1,3-dihydroinden-2-ol is sourced from PubChem (CID 118588844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).