About 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate
2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate (PubChem CID 118588868) has the molecular formula C16H12ClN3O3
and a molecular weight of 329.74 g/mol. Its IUPAC name is 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate.
Molecular Properties
| Compound Name | 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate |
| PubChem CID | 118588868 |
| Molecular Formula | C16H12ClN3O3 |
| Molecular Weight | 329.74 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate |
| SMILES | N#Cc1ccc(CNC(=O)OC2COc3ncccc32)c(Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O3/c17-13-6-10(7-18)3-4-11(13)8-20-16(21)23-14-9-22-15-12(14)2-1-5-19-15/h1-6,14H,8-9H2,(H,20,21) |
| InChIKey | XPRXXZCDDONPRB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate?
The IUPAC name of 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate (CID 118588868) is 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate.
What is the SMILES notation for 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate?
The canonical SMILES for 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate is N#Cc1ccc(CNC(=O)OC2COc3ncccc32)c(Cl)c1.
What is the InChIKey of 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate?
The InChIKey is XPRXXZCDDONPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN3O3/c17-13-6-10(7-18)3-4-11(13)8-20-16(21)23-14-9-22-15-12(14)2-1-5-19-15/h1-6,14H,8-9H2,(H,20,21).
What are the key properties of 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate?
2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate has a molecular weight of 329.74 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuro[2,3-b]pyridin-3-yl N-[(2-chloro-4-cyanophenyl)methyl]carbamate is sourced from PubChem (CID 118588868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).