About 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol
3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol (PubChem CID 118588919) has the molecular formula C16H24F3NOS
and a molecular weight of 335.44 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol.
Molecular Properties
| Compound Name | 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol |
| PubChem CID | 118588919 |
| Molecular Formula | C16H24F3NOS |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol |
| SMILES | CCCCCCC(N)C(O)(c1ccc(SC)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H24F3NOS/c1-3-4-5-6-7-14(20)15(21,16(17,18)19)12-8-10-13(22-2)11-9-12/h8-11,14,21H,3-7,20H2,1-2H3 |
| InChIKey | YOTMEKFOHLQLSW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol?
The IUPAC name of 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol (CID 118588919) is 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol.
What is the SMILES notation for 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol?
The canonical SMILES for 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol is CCCCCCC(N)C(O)(c1ccc(SC)cc1)C(F)(F)F.
What is the InChIKey of 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol?
The InChIKey is YOTMEKFOHLQLSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F3NOS/c1-3-4-5-6-7-14(20)15(21,16(17,18)19)12-8-10-13(22-2)11-9-12/h8-11,14,21H,3-7,20H2,1-2H3.
What are the key properties of 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol?
3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol has a molecular weight of 335.44 g/mol, XLogP of 4.46, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1,1-trifluoro-2-(4-methylsulfanylphenyl)nonan-2-ol is sourced from PubChem (CID 118588919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).