About 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate
2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate (PubChem CID 118588931) has the molecular formula C8H7NO4
and a molecular weight of 181.15 g/mol. Its IUPAC name is 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate |
| PubChem CID | 118588931 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate |
| SMILES | O=C(O)OC1COc2ncccc21 |
| InChI | InChI=1S/C8H7NO4/c10-8(11)13-6-4-12-7-5(6)2-1-3-9-7/h1-3,6H,4H2,(H,10,11) |
| InChIKey | WRJTYOWVCJZFPK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate?
The IUPAC name of 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate (CID 118588931) is 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate.
What is the SMILES notation for 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate?
The canonical SMILES for 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate is O=C(O)OC1COc2ncccc21.
What is the InChIKey of 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate?
The InChIKey is WRJTYOWVCJZFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c10-8(11)13-6-4-12-7-5(6)2-1-3-9-7/h1-3,6H,4H2,(H,10,11).
What are the key properties of 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate?
2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate has a molecular weight of 181.15 g/mol, XLogP of 1.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrofuro[2,3-b]pyridin-3-yl hydrogen carbonate is sourced from PubChem (CID 118588931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).