C16H20ClFO — CID 118589358
trans-(1R,6S)-1-(4-chloro-3-fluorophenyl)-2,2,6-trimethylcyclohexane-1-carbaldehyde (PubChem CID 118589358) has the molecular formula C16H20ClFO and a molecular weight of 282.79 g/mol. Its IUPAC name is trans-(1R,6S)-1-(4-chloro-3-fluorophenyl)-2,2,6-trimethylcyclohexane-1-carbaldehyde.
| Compound Name | trans-(1R,6S)-1-(4-chloro-3-fluorophenyl)-2,2,6-trimethylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 118589358 |
| Molecular Formula | C16H20ClFO |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | trans-(1R,6S)-1-(4-chloro-3-fluorophenyl)-2,2,6-trimethylcyclohexane-1-carbaldehyde |
| SMILES | C[C@H]1CCCC(C)(C)[C@@]1(C=O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H20ClFO/c1-11-5-4-8-15(2,3)16(11,10-19)12-6-7-13(17)14(18)9-12/h6-7,9-11H,4-5,8H2,1-3H3/t11-,16+/m0/s1 |
| InChIKey | YWLKQUKXKCFYAN-MEDUHNTESA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|