C6HF5N2 — CID 118589404
2-(1,1,1,3,3-pentafluoropropan-2-ylidene)propanedinitrile (PubChem CID 118589404) has the molecular formula C6HF5N2 and a molecular weight of 196.08 g/mol. Its IUPAC name is 2-(1,1,1,3,3-pentafluoropropan-2-ylidene)propanedinitrile.
| Compound Name | 2-(1,1,1,3,3-pentafluoropropan-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 118589404 |
| Molecular Formula | C6HF5N2 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2-(1,1,1,3,3-pentafluoropropan-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C6HF5N2/c7-5(8)4(6(9,10)11)3(1-12)2-13/h5H |
| InChIKey | RBICLFYEDLXKIM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|