C5H10N2O4 — CID 118589539
[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamic acid (PubChem CID 118589539) has the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. Its IUPAC name is [(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118589539 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | [(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]carbamic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)O)C(N)=O |
| InChI | InChI=1S/C5H10N2O4/c1-2(8)3(4(6)9)7-5(10)11/h2-3,7-8H,1H3,(H2,6,9)(H,10,11)/t2-,3+/m1/s1 |
| InChIKey | KNHBWAWATFCELA-GBXIJSLDSA-N |
| XLogP | -1.51 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |