About 7H-chromene-5,6-dione
7H-chromene-5,6-dione (PubChem CID 118589898) has the molecular formula C9H6O3
and a molecular weight of 162.14 g/mol. Its IUPAC name is 7H-chromene-5,6-dione.
Molecular Properties
| Compound Name | 7H-chromene-5,6-dione |
| PubChem CID | 118589898 |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 7H-chromene-5,6-dione |
| SMILES | O=C1CC=C2OC=CC=C2C1=O |
| InChI | InChI=1S/C9H6O3/c10-7-3-4-8-6(9(7)11)2-1-5-12-8/h1-2,4-5H,3H2 |
| InChIKey | VDLRLIRESXUMOZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7H-chromene-5,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-chromene-5,6-dione?
The IUPAC name of 7H-chromene-5,6-dione (CID 118589898) is 7H-chromene-5,6-dione.
What is the SMILES notation for 7H-chromene-5,6-dione?
The canonical SMILES for 7H-chromene-5,6-dione is O=C1CC=C2OC=CC=C2C1=O.
What is the InChIKey of 7H-chromene-5,6-dione?
The InChIKey is VDLRLIRESXUMOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O3/c10-7-3-4-8-6(9(7)11)2-1-5-12-8/h1-2,4-5H,3H2.
What are the key properties of 7H-chromene-5,6-dione?
7H-chromene-5,6-dione has a molecular weight of 162.14 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-chromene-5,6-dione is sourced from PubChem (CID 118589898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).