C24H29N7O — CID 118590041
1-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol (PubChem CID 118590041) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol.
| Compound Name | 1-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 118590041 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[[9-propan-2-yl-6-[(4-pyridin-2-ylphenyl)methylamino]purin-2-yl]amino]butan-1-ol |
| SMILES | CCCC(O)Nc1nc(NCc2ccc(-c3ccccn3)cc2)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C24H29N7O/c1-4-7-20(32)28-24-29-22(21-23(30-24)31(15-27-21)16(2)3)26-14-17-9-11-18(12-10-17)19-8-5-6-13-25-19/h5-6,8-13,15-16,20,32H,4,7,14H2,1-3H3,(H2,26,28,29,30) |
| InChIKey | IQBNPNUWFLQZRD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|