About 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione
9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione (PubChem CID 11859071) has the molecular formula C14H12N2O3
and a molecular weight of 256.26 g/mol. Its IUPAC name is 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione.
Molecular Properties
| Compound Name | 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione |
| PubChem CID | 11859071 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione |
| SMILES | COC1=C(C)C(=O)c2ccn3c(C)ncc3c2C1=O |
| InChI | InChI=1S/C14H12N2O3/c1-7-12(17)9-4-5-16-8(2)15-6-10(16)11(9)13(18)14(7)19-3/h4-6H,1-3H3 |
| InChIKey | QLEWSFDAEOCUAV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione?
The IUPAC name of 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione (CID 11859071) is 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione.
What is the SMILES notation for 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione?
The canonical SMILES for 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione is COC1=C(C)C(=O)c2ccn3c(C)ncc3c2C1=O.
What is the InChIKey of 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione?
The InChIKey is QLEWSFDAEOCUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c1-7-12(17)9-4-5-16-8(2)15-6-10(16)11(9)13(18)14(7)19-3/h4-6H,1-3H3.
What are the key properties of 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione?
9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione has a molecular weight of 256.26 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxy-3,8-dimethylimidazo[5,1-a]isoquinoline-7,10-dione is sourced from PubChem (CID 11859071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).