C26H36N8O3 — CID 11859094
N-[2-[2-[2-[[4-(butylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 11859094) has the molecular formula C26H36N8O3 and a molecular weight of 508.63 g/mol. Its IUPAC name is N-[2-[2-[2-[[4-(butylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | N-[2-[2-[2-[[4-(butylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 11859094 |
| Molecular Formula | C26H36N8O3 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | N-[2-[2-[2-[[4-(butylamino)-6-(pyridin-2-ylmethylamino)-1,3,5-triazin-2-yl]amino]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | CCCCNc1nc(NCCOCCOCCNC(=O)c2ccccc2)nc(NCc2ccccn2)n1 |
| InChI | InChI=1S/C26H36N8O3/c1-2-3-12-29-24-32-25(34-26(33-24)31-20-22-11-7-8-13-27-22)30-15-17-37-19-18-36-16-14-28-23(35)21-9-5-4-6-10-21/h4-11,13H,2-3,12,14-20H2,1H3,(H,28,35)(H3,29,30,31,32,33,34) |
| InChIKey | RUQCGMKFYNTBHZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|