About 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole
3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole (PubChem CID 118591317) has the molecular formula C21H28N4O3
and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole |
| PubChem CID | 118591317 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole |
| SMILES | CCOC1(OCCC2CCN(c3ccc(C)nn3)CC2)NOc2ccccc21 |
| InChI | InChI=1S/C21H28N4O3/c1-3-26-21(18-6-4-5-7-19(18)28-24-21)27-15-12-17-10-13-25(14-11-17)20-9-8-16(2)22-23-20/h4-9,17,24H,3,10-15H2,1-2H3 |
| InChIKey | GWUUGCWSJSGMKJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole?
The IUPAC name of 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole (CID 118591317) is 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole.
What is the SMILES notation for 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole?
The canonical SMILES for 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole is CCOC1(OCCC2CCN(c3ccc(C)nn3)CC2)NOc2ccccc21.
What is the InChIKey of 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole?
The InChIKey is GWUUGCWSJSGMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O3/c1-3-26-21(18-6-4-5-7-19(18)28-24-21)27-15-12-17-10-13-25(14-11-17)20-9-8-16(2)22-23-20/h4-9,17,24H,3,10-15H2,1-2H3.
What are the key properties of 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole?
3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole has a molecular weight of 384.48 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-3-[2-[1-(6-methylpyridazin-3-yl)piperidin-4-yl]ethoxy]-2H-1,2-benzoxazole is sourced from PubChem (CID 118591317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).