C7H7N3O — CID 118591416
1-oxido-3,4-dihydropyrido[2,3-b]pyrazin-1-ium (PubChem CID 118591416) has the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. Its IUPAC name is 1-oxido-3,4-dihydropyrido[2,3-b]pyrazin-1-ium.
| Compound Name | 1-oxido-3,4-dihydropyrido[2,3-b]pyrazin-1-ium |
|---|---|
| PubChem CID | 118591416 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 1-oxido-3,4-dihydropyrido[2,3-b]pyrazin-1-ium |
| SMILES | [O-][N+]1=CCNc2ncccc21 |
| InChI | InChI=1S/C7H7N3O/c11-10-5-4-9-7-6(10)2-1-3-8-7/h1-3,5H,4H2,(H,8,9) |
| InChIKey | ZYRIVWSZCSHDKV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 50.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|