About 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid
4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid (PubChem CID 118591949) has the molecular formula C17H14N4O3
and a molecular weight of 322.32 g/mol. Its IUPAC name is 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid |
| PubChem CID | 118591949 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid |
| SMILES | CC(=O)c1nc(N)c(-c2ccc(C(=O)O)c3ccccc23)nc1N |
| InChI | InChI=1S/C17H14N4O3/c1-8(22)13-15(18)21-14(16(19)20-13)11-6-7-12(17(23)24)10-5-3-2-4-9(10)11/h2-7H,1H3,(H2,18,21)(H2,19,20)(H,23,24) |
| InChIKey | VLLMMRCLFLMUQY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid?
The IUPAC name of 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid (CID 118591949) is 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid.
What is the SMILES notation for 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid?
The canonical SMILES for 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid is CC(=O)c1nc(N)c(-c2ccc(C(=O)O)c3ccccc23)nc1N.
What is the InChIKey of 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid?
The InChIKey is VLLMMRCLFLMUQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O3/c1-8(22)13-15(18)21-14(16(19)20-13)11-6-7-12(17(23)24)10-5-3-2-4-9(10)11/h2-7H,1H3,(H2,18,21)(H2,19,20)(H,23,24).
What are the key properties of 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid?
4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid has a molecular weight of 322.32 g/mol, XLogP of 2.36, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-acetyl-3,6-diaminopyrazin-2-yl)naphthalene-1-carboxylic acid is sourced from PubChem (CID 118591949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).