C18H32O6 — CID 118592118
1-[(3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanone (PubChem CID 118592118) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[(3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanone.
| Compound Name | 1-[(3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanone |
|---|---|
| PubChem CID | 118592118 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(3aS,5R,6aS)-6-butoxy-5-(butoxymethyl)-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethanone |
| SMILES | CCCCOC[C@@]1(C(C)=O)O[C@H]2OC(C)(C)O[C@H]2C1OCCCC |
| InChI | InChI=1S/C18H32O6/c1-6-8-10-20-12-18(13(3)19)15(21-11-9-7-2)14-16(24-18)23-17(4,5)22-14/h14-16H,6-12H2,1-5H3/t14-,15?,16+,18-/m0/s1 |
| InChIKey | NXIWVBHLEACWDX-NCKFVVHJSA-N |
| XLogP | 2.82 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|