About CID 118592345
CID 118592345 (PubChem CID 118592345) has the molecular formula C29H30F3N3O
and a molecular weight of 493.57 g/mol.
Molecular Properties
| Compound Name | CID 118592345 |
| PubChem CID | 118592345 |
| Molecular Formula | C29H30F3N3O |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | — |
| SMILES | C=C1/C=C\C=C/CCCC2(CC1)Cc1ccc(-c3cccc(C(F)(F)F)c3)cc1C21N=C(N)N(C)O1 |
| InChI | InChI=1S/C29H30F3N3O/c1-20-9-6-4-3-5-7-15-27(16-14-20)19-23-13-12-22(21-10-8-11-24(17-21)29(30,31)32)18-25(23)28(27)34-26(33)35(2)36-28/h3-4,6,8-13,17-18H,1,5,7,14-16,19H2,2H3,(H2,33,34)/b4-3-,9-6- |
| InChIKey | VGYGWMDHBQBZMV-UBCGXMOYSA-N |
| XLogP | 6.89 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 118592345 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 118592345?
The IUPAC name of CID 118592345 (CID 118592345) is not available.
What is the SMILES notation for CID 118592345?
The canonical SMILES for CID 118592345 is C=C1/C=C\C=C/CCCC2(CC1)Cc1ccc(-c3cccc(C(F)(F)F)c3)cc1C21N=C(N)N(C)O1.
What is the InChIKey of CID 118592345?
The InChIKey is VGYGWMDHBQBZMV-UBCGXMOYSA-N. The full InChI is InChI=1S/C29H30F3N3O/c1-20-9-6-4-3-5-7-15-27(16-14-20)19-23-13-12-22(21-10-8-11-24(17-21)29(30,31)32)18-25(23)28(27)34-26(33)35(2)36-28/h3-4,6,8-13,17-18H,1,5,7,14-16,19H2,2H3,(H2,33,34)/b4-3-,9-6-.
What are the key properties of CID 118592345?
CID 118592345 has a molecular weight of 493.57 g/mol, XLogP of 6.89, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 118592345 is sourced from PubChem (CID 118592345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).