About 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene
5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene (PubChem CID 118592560) has the molecular formula C12H13ClS
and a molecular weight of 224.76 g/mol. Its IUPAC name is 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene |
| PubChem CID | 118592560 |
| Molecular Formula | C12H13ClS |
| Molecular Weight | 224.76 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene |
| SMILES | ClC1C=CC(SC2=CC=CCC2)=CC1 |
| InChI | InChI=1S/C12H13ClS/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-2,4,6,8-10H,3,5,7H2 |
| InChIKey | PEXZYYHFYHDJBF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene?
The IUPAC name of 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene (CID 118592560) is 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene.
What is the SMILES notation for 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene?
The canonical SMILES for 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene is ClC1C=CC(SC2=CC=CCC2)=CC1.
What is the InChIKey of 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene?
The InChIKey is PEXZYYHFYHDJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClS/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-2,4,6,8-10H,3,5,7H2.
What are the key properties of 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene?
5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene has a molecular weight of 224.76 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-cyclohexa-1,3-dien-1-ylsulfanylcyclohexa-1,3-diene is sourced from PubChem (CID 118592560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).