About 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene
1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene (PubChem CID 118592689) has the molecular formula C13H5BrF6O
and a molecular weight of 371.07 g/mol. Its IUPAC name is 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene.
Molecular Properties
| Compound Name | 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene |
| PubChem CID | 118592689 |
| Molecular Formula | C13H5BrF6O |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene |
| SMILES | Fc1ccc(OC(F)(F)c2ccc(Br)c(F)c2F)cc1F |
| InChI | InChI=1S/C13H5BrF6O/c14-8-3-2-7(11(17)12(8)18)13(19,20)21-6-1-4-9(15)10(16)5-6/h1-5H |
| InChIKey | OEGLUKSXXNZLLP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene?
The IUPAC name of 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene (CID 118592689) is 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene.
What is the SMILES notation for 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene?
The canonical SMILES for 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene is Fc1ccc(OC(F)(F)c2ccc(Br)c(F)c2F)cc1F.
What is the InChIKey of 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene?
The InChIKey is OEGLUKSXXNZLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5BrF6O/c14-8-3-2-7(11(17)12(8)18)13(19,20)21-6-1-4-9(15)10(16)5-6/h1-5H.
What are the key properties of 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene?
1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene has a molecular weight of 371.07 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[(3,4-difluorophenoxy)-difluoromethyl]-2,3-difluorobenzene is sourced from PubChem (CID 118592689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).