C18H10Cl2F7N — CID 118593011
6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole (PubChem CID 118593011) has the molecular formula C18H10Cl2F7N and a molecular weight of 444.18 g/mol. Its IUPAC name is 6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole.
| Compound Name | 6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole |
|---|---|
| PubChem CID | 118593011 |
| Molecular Formula | C18H10Cl2F7N |
| Molecular Weight | 444.18 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 6-chloro-5-(2-chloro-4-methylphenyl)-2-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-indole |
| SMILES | Cc1ccc(-c2cc3cc(C(F)(F)C(F)(F)C(F)(F)F)[nH]c3cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl2F7N/c1-8-2-3-10(12(19)4-8)11-5-9-6-15(28-14(9)7-13(11)20)16(21,22)17(23,24)18(25,26)27/h2-7,28H,1H3 |
| InChIKey | QJXVVPBCSURYRD-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.18 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|