C48H62N8O4 — CID 118593041
tert-butyl N-[(5S)-5-amino-6-[4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[3-pyridin-2-yl-2-(pyridin-2-ylmethyl)propyl]phenoxy]butylamino]-6-oxohexyl]carbamate (PubChem CID 118593041) has the molecular formula C48H62N8O4 and a molecular weight of 815.08 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-amino-6-[4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[3-pyridin-2-yl-2-(pyridin-2-ylmethyl)propyl]phenoxy]butylamino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-amino-6-[4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[3-pyridin-2-yl-2-(pyridin-2-ylmethyl)propyl]phenoxy]butylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 118593041 |
| Molecular Formula | C48H62N8O4 |
| Molecular Weight | 815.08 g/mol |
| Exact Mass | 814.49 |
| IUPAC Name | tert-butyl N-[(5S)-5-amino-6-[4-[3-[[bis(pyridin-2-ylmethyl)amino]methyl]-5-[3-pyridin-2-yl-2-(pyridin-2-ylmethyl)propyl]phenoxy]butylamino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](N)C(=O)NCCCCOc1cc(CC(Cc2ccccn2)Cc2ccccn2)cc(CN(Cc2ccccn2)Cc2ccccn2)c1 |
| InChI | InChI=1S/C48H62N8O4/c1-48(2,3)60-47(58)55-26-13-8-20-45(49)46(57)54-25-14-15-27-59-44-32-37(28-38(30-40-16-4-9-21-50-40)31-41-17-5-10-22-51-41)29-39(33-44)34-56(35-42-18-6-11-23-52-42)36-43-19-7-12-24-53-43/h4-7,9-12,16-19,21-24,29,32-33,38,45H,8,13-15,20,25-28,30-31,34-36,49H2,1-3H3,(H,54,57)(H,55,58)/t45-/m0/s1 |
| InChIKey | MPVXMXKMFAMMIK-GWHBCOKCSA-N |
| XLogP | 7.41 |
| TPSA | 157.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.08 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|