About 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid
2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid (PubChem CID 118593260) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid |
| PubChem CID | 118593260 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(C(=O)Nc2ccc(C)c(C)n2)cc1C |
| InChI | InChI=1S/C17H18N2O3/c1-9-5-6-15(18-12(9)4)19-16(20)13-7-10(2)11(3)8-14(13)17(21)22/h5-8H,1-4H3,(H,21,22)(H,18,19,20) |
| InChIKey | NAWYAMCPEHMVDO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid?
The IUPAC name of 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid (CID 118593260) is 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid.
What is the SMILES notation for 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid?
The canonical SMILES for 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid is Cc1cc(C(=O)O)c(C(=O)Nc2ccc(C)c(C)n2)cc1C.
What is the InChIKey of 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid?
The InChIKey is NAWYAMCPEHMVDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-9-5-6-15(18-12(9)4)19-16(20)13-7-10(2)11(3)8-14(13)17(21)22/h5-8H,1-4H3,(H,21,22)(H,18,19,20).
What are the key properties of 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid?
2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid has a molecular weight of 298.34 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dimethyl-2-pyridinyl)carbamoyl]-4,5-dimethylbenzoic acid is sourced from PubChem (CID 118593260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).