C48H58O8 — CID 118593439
4-[[4-[bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]methyl]phenyl]-(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol (PubChem CID 118593439) has the molecular formula C48H58O8 and a molecular weight of 762.98 g/mol. Its IUPAC name is 4-[[4-[bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]methyl]phenyl]-(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol.
| Compound Name | 4-[[4-[bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]methyl]phenyl]-(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol |
|---|---|
| PubChem CID | 118593439 |
| Molecular Formula | C48H58O8 |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.41 |
| IUPAC Name | 4-[[4-[bis[4-hydroxy-3,5-bis(methoxymethyl)phenyl]methyl]phenyl]-(3,5-diethyl-4-hydroxyphenyl)methyl]-2,6-diethylphenol |
| SMILES | CCc1cc(C(c2ccc(C(c3cc(COC)c(O)c(COC)c3)c3cc(COC)c(O)c(COC)c3)cc2)c2cc(CC)c(O)c(CC)c2)cc(CC)c1O |
| InChI | InChI=1S/C48H58O8/c1-9-29-17-35(18-30(10-2)45(29)49)43(36-19-31(11-3)46(50)32(12-4)20-36)33-13-15-34(16-14-33)44(37-21-39(25-53-5)47(51)40(22-37)26-54-6)38-23-41(27-55-7)48(52)42(24-38)28-56-8/h13-24,43-44,49-52H,9-12,25-28H2,1-8H3 |
| InChIKey | PBYDGWIQIVIPEW-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|