About methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate
methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate (PubChem CID 118593683) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate.
Molecular Properties
| Compound Name | methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate |
| PubChem CID | 118593683 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)C1=C(C)C[C@H](C)OC1=O |
| InChI | InChI=1S/C16H24O5/c1-11-10-12(2)21-16(19)15(11)13(17)8-6-4-5-7-9-14(18)20-3/h12H,4-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | UOPRYGGRIGQSBB-LBPRGKRZSA-N |
| XLogP | 2.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate?
The IUPAC name of methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate (CID 118593683) is methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate.
What is the SMILES notation for methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate?
The canonical SMILES for methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate is COC(=O)CCCCCCC(=O)C1=C(C)C[C@H](C)OC1=O.
What is the InChIKey of methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate?
The InChIKey is UOPRYGGRIGQSBB-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H24O5/c1-11-10-12(2)21-16(19)15(11)13(17)8-6-4-5-7-9-14(18)20-3/h12H,4-10H2,1-3H3/t12-/m0/s1.
What are the key properties of methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate?
methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate has a molecular weight of 296.36 g/mol, XLogP of 2.72, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(2S)-2,4-dimethyl-6-oxo-2,3-dihydropyran-5-yl]-8-oxooctanoate is sourced from PubChem (CID 118593683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).