C25H22N2O4 — CID 118593700
2-[(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl)methyl]-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione (PubChem CID 118593700) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-[(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl)methyl]-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione.
| Compound Name | 2-[(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl)methyl]-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118593700 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[(1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-2-yl)methyl]-3a,4,9,9a-tetrahydrobenzo[f]isoindole-1,3-dione |
| SMILES | O=C1C2Cc3ccccc3CC2C(=O)N1CN1C(=O)C2Cc3ccccc3CC2C1=O |
| InChI | InChI=1S/C25H22N2O4/c28-22-18-9-14-5-1-2-6-15(14)10-19(18)23(29)26(22)13-27-24(30)20-11-16-7-3-4-8-17(16)12-21(20)25(27)31/h1-8,18-21H,9-13H2 |
| InChIKey | OQXBYZXECYWCGZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|