About N'-cyano-2,5-dihydropyrrole-1-carboximidamide
N'-cyano-2,5-dihydropyrrole-1-carboximidamide (PubChem CID 118593777) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is N'-cyano-2,5-dihydropyrrole-1-carboximidamide.
Molecular Properties
| Compound Name | N'-cyano-2,5-dihydropyrrole-1-carboximidamide |
| PubChem CID | 118593777 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | N'-cyano-2,5-dihydropyrrole-1-carboximidamide |
| SMILES | N#C/N=C(\N)N1CC=CC1 |
| InChI | InChI=1S/C6H8N4/c7-5-9-6(8)10-3-1-2-4-10/h1-2H,3-4H2,(H2,8,9) |
| InChIKey | VSXGQMBWHVQWJJ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-cyano-2,5-dihydropyrrole-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyano-2,5-dihydropyrrole-1-carboximidamide?
The IUPAC name of N'-cyano-2,5-dihydropyrrole-1-carboximidamide (CID 118593777) is N'-cyano-2,5-dihydropyrrole-1-carboximidamide.
What is the SMILES notation for N'-cyano-2,5-dihydropyrrole-1-carboximidamide?
The canonical SMILES for N'-cyano-2,5-dihydropyrrole-1-carboximidamide is N#C/N=C(\N)N1CC=CC1.
What is the InChIKey of N'-cyano-2,5-dihydropyrrole-1-carboximidamide?
The InChIKey is VSXGQMBWHVQWJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-5-9-6(8)10-3-1-2-4-10/h1-2H,3-4H2,(H2,8,9).
What are the key properties of N'-cyano-2,5-dihydropyrrole-1-carboximidamide?
N'-cyano-2,5-dihydropyrrole-1-carboximidamide has a molecular weight of 136.16 g/mol, XLogP of -0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyano-2,5-dihydropyrrole-1-carboximidamide is sourced from PubChem (CID 118593777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).