C17H26NO5P — CID 118593859
3-[(2S,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enyl-3H-pyridine-2,6-dione (PubChem CID 118593859) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is 3-[(2S,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enyl-3H-pyridine-2,6-dione.
| Compound Name | 3-[(2S,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enyl-3H-pyridine-2,6-dione |
|---|---|
| PubChem CID | 118593859 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-[(2S,3R,4S,5R)-5-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-3,4-dihydroxyoxolan-2-yl]-5-prop-2-enyl-3H-pyridine-2,6-dione |
| SMILES | C=CCC1=CC([C@@H]2O[C@H](CCP(=C)(C)C)[C@@H](O)[C@H]2O)C(=O)NC1=O |
| InChI | InChI=1S/C17H26NO5P/c1-5-6-10-9-11(17(22)18-16(10)21)15-14(20)13(19)12(23-15)7-8-24(2,3)4/h5,9,11-15,19-20H,1-2,6-8H2,3-4H3,(H,18,21,22)/t11?,12-,13-,14-,15+/m1/s1 |
| InChIKey | BFEXUDKVHZLQRA-CVFKAICRSA-N |
| XLogP | 0.35 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|