About 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane
2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane (PubChem CID 118593914) has the molecular formula C15H19F3O2S
and a molecular weight of 320.38 g/mol. Its IUPAC name is 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane |
| PubChem CID | 118593914 |
| Molecular Formula | C15H19F3O2S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane |
| SMILES | CCCC1(F)COC(c2ccc(SCC)c(F)c2F)OC1 |
| InChI | InChI=1S/C15H19F3O2S/c1-3-7-15(18)8-19-14(20-9-15)10-5-6-11(21-4-2)13(17)12(10)16/h5-6,14H,3-4,7-9H2,1-2H3 |
| InChIKey | NPXMGDUKBMHYHA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane?
The IUPAC name of 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane (CID 118593914) is 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane.
What is the SMILES notation for 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane?
The canonical SMILES for 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane is CCCC1(F)COC(c2ccc(SCC)c(F)c2F)OC1.
What is the InChIKey of 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane?
The InChIKey is NPXMGDUKBMHYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3O2S/c1-3-7-15(18)8-19-14(20-9-15)10-5-6-11(21-4-2)13(17)12(10)16/h5-6,14H,3-4,7-9H2,1-2H3.
What are the key properties of 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane?
2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane has a molecular weight of 320.38 g/mol, XLogP of 4.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylsulfanyl-2,3-difluorophenyl)-5-fluoro-5-propyl-1,3-dioxane is sourced from PubChem (CID 118593914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).