C43H40FN5O5 — CID 118594323
[(3S,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-3-ethynyl-5-fluoro-4-methyloxolan-3-yl] benzoate (PubChem CID 118594323) has the molecular formula C43H40FN5O5 and a molecular weight of 725.82 g/mol. Its IUPAC name is [(3S,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-3-ethynyl-5-fluoro-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(3S,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-3-ethynyl-5-fluoro-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 118594323 |
| Molecular Formula | C43H40FN5O5 |
| Molecular Weight | 725.82 g/mol |
| Exact Mass | 725.30 |
| IUPAC Name | [(3S,4S,5S)-2-[6-ethoxy-2-[[(4-methoxyphenyl)-diphenylmethyl]amino]purin-9-yl]-5-ethyl-3-ethynyl-5-fluoro-4-methyloxolan-3-yl] benzoate |
| SMILES | C#C[C@]1(OC(=O)c2ccccc2)C(n2cnc3c(OCC)nc(NC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)nc32)O[C@](F)(CC)[C@H]1C |
| InChI | InChI=1S/C43H40FN5O5/c1-6-41(53-38(50)30-18-12-9-13-19-30)29(4)42(44,7-2)54-39(41)49-28-45-35-36(49)46-40(47-37(35)52-8-3)48-43(31-20-14-10-15-21-31,32-22-16-11-17-23-32)33-24-26-34(51-5)27-25-33/h1,9-29,39H,7-8H2,2-5H3,(H,46,47,48)/t29-,39?,41+,42+/m0/s1 |
| InChIKey | RVKOYHNFBGGUGJ-QSEKTVEQSA-N |
| XLogP | 8.11 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.82 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|