C29H36F3N7O5 — CID 118594514
tert-butyl N-[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamate (PubChem CID 118594514) has the molecular formula C29H36F3N7O5 and a molecular weight of 619.65 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 118594514 |
| Molecular Formula | C29H36F3N7O5 |
| Molecular Weight | 619.65 g/mol |
| Exact Mass | 619.27 |
| IUPAC Name | tert-butyl N-[3-[[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)CNC(=O)c1ccc(Nc2nc(NCc3ccc(O)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C29H36F3N7O5/c1-27(2,3)44-26(42)35-16-28(4,5)15-34-22(41)19-8-10-20(11-9-19)36-24-37-23(33-14-18-6-12-21(40)13-7-18)38-25(39-24)43-17-29(30,31)32/h6-13,40H,14-17H2,1-5H3,(H,34,41)(H,35,42)(H2,33,36,37,38,39) |
| InChIKey | RKOPGCFGZQQSKQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |